ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
שם המוצר |
3,5-Dichlorophenylhydrazine |
שם אנגלי |
3,5-Dichlorophenylhydrazine; |
מולקולרית פורמולה |
C6H6Cl2N2 |
משקל מולקולרי |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
מספר CAS |
39943-56-1 |
מבנה מולקולרי |
|
צפיפות |
1.475g/cm3 |
נקודת רתיחה |
286.1°C at 760 mmHg |
משקל סגולי |
1.665 |
נקודת הבזק |
126.8°C |
לחץ אדים |
0.0027mmHg at 25°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|