ChemNet > CAS > 818-38-2 diethyl glutarate
818-38-2 diethyl glutarate
| Ονομασία του προϊόντος |
diethyl glutarate |
| Συνώνυμα |
Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
| MF |
C9H16O4 |
| Μοριακό βάρος |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| CAS ΟΧΙ |
818-38-2 |
| EINECS |
212-451-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.022g/cm3 |
| Σημείο βρασμού |
236.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.427 |
| Σημείο ανάφλεξης |
96.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
