818-38-2 diethyl glutarate
produktnavn |
diethyl glutarate |
Engelsk navn |
diethyl glutarate; Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
Molekylær Formel |
C9H16O4 |
Molekylvekt |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
CAS-nummer |
818-38-2 |
EINECS |
212-451-2 |
Molecular Structure |
|
Tetthet |
1.022g/cm3 |
Kokepunkt |
236.5°C at 760 mmHg |
Brytningsindeks |
1.427 |
Flammepunktet |
96.1°C |
Damptrykk |
0.0472mmHg at 25°C |
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|