446-22-0 2'-fluoropropiophenone
termék neve |
2'-fluoropropiophenone |
Angol név |
2'-fluoropropiophenone; 2'-fluoro-1-phenylpropan-1-one; 1-(2'-fluorophenyl)propan-1-one; 2-Fluoropropiophenone |
MF |
C9H9FO |
Molekulatömeg |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
CAS-szám |
446-22-0 |
EINECS |
244-220-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.074g/cm3 |
Forráspont |
204.119°C at 760 mmHg |
Törésmutató |
1.489 |
Gyulladáspont |
77.067°C |
Gőznyomás |
0.268mmHg at 25°C |
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|