446-22-0 2'-fluoropropiophenone
Nome del prodotto |
2'-fluoropropiophenone |
Nome inglese |
2'-fluoropropiophenone; 2'-fluoro-1-phenylpropan-1-one; 1-(2'-fluorophenyl)propan-1-one; 2-Fluoropropiophenone |
Formula molecolare |
C9H9FO |
Peso Molecolare |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
Numero CAS |
446-22-0 |
EINECS |
244-220-7 |
Struttura molecolare |
|
Densità |
1.074g/cm3 |
Punto di ebollizione |
204.119°C at 760 mmHg |
Indice di rifrazione |
1.489 |
Punto d'infiammabilità |
77.067°C |
Pressione di vapore |
0.268mmHg at 25°C |
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|