446-22-0 2'-fluoropropiophenone
نام محصول |
2'-fluoropropiophenone |
نام انگلیسی |
2'-fluoropropiophenone; 2'-fluoro-1-phenylpropan-1-one; 1-(2'-fluorophenyl)propan-1-one; 2-Fluoropropiophenone |
میدان مغناطیسی |
C9H9FO |
وزن مولکولی |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
شماره سیایاس |
446-22-0 |
تعداد کمیسیون اروپایی |
244-220-7 |
ساختار مولکولی |
|
تراکم |
1.074g/cm3 |
نقطه غلیان |
204.119°C at 760 mmHg |
ضریب شکست |
1.489 |
نقطه اشتعال |
77.067°C |
فشار بخار |
0.268mmHg at 25°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|