62936-23-6 5-Chlorovanillic acid
| termék neve |
5-Chlorovanillic acid |
| Angol név |
5-Chlorovanillic acid; 5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
| MF |
C8H7ClO4 |
| Molekulatömeg |
202.5918 |
| InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
| CAS-szám |
62936-23-6 |
| EINECS |
263-766-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.485g/cm3 |
| Olvadáspont |
241-243℃ |
| Forráspont |
352.3°C at 760 mmHg |
| Törésmutató |
1.599 |
| Gyulladáspont |
166.9°C |
| Gőznyomás |
1.44E-05mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|