ChemNet > CAS > 62936-23-6 5-Chlorovanillic acid
62936-23-6 5-Chlorovanillic acid
| اسم المنتج |
5-Chlorovanillic acid |
| الاسم المستعار |
5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
| الصيغة الجزيئية |
C8H7ClO4 |
| الوزن الجزيئي الغرامي |
202.5918 |
| InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
| إستراتيجية المساعدة القطرية |
62936-23-6 |
| المفوضية الأوروبية رقم |
263-766-7 |
| بنية جزيئية |
|
| كثافة |
1.485g/cm3 |
| درجة الإنصهار |
241-243℃ |
| نقطة الغليان |
352.3°C at 760 mmHg |
| معامل الإنكسار |
1.599 |
| نقطة الوميض |
166.9°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
