ChemNet > CAS > 7151-68-0 3-Methoxy-4-methylbenzoic acid
7151-68-0 3-Methoxy-4-methylbenzoic acid
termék neve |
3-Methoxy-4-methylbenzoic acid |
Angol név |
3-Methoxy-4-methylbenzoic acid; 4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid~4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid (COOH=1); 3-methoxy-4-methylbenzoate |
MF |
C9H9O3 |
Molekulatömeg |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5H,1-2H3,(H,10,11)/p-1 |
CAS-szám |
7151-68-0 |
EINECS |
230-486-1 |
Molekuláris szerkezete |
|
Olvadáspont |
152-154℃ |
Forráspont |
309.9°C at 760 mmHg |
Gyulladáspont |
126.2°C |
Gőznyomás |
0.000267mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S24/25:;
|
|