ChemNet > CAS > 10534-89-1 Hexaaminecobalt(III) chloride
10534-89-1 Hexaaminecobalt(III) chloride
| उत्पाद का नाम |
Hexaaminecobalt(III) chloride |
| समानार्थी |
Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
| आणविक फार्मूला |
C6H12ClCoN4 |
| आण्विक वजन |
234.5719 |
| InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
| कैस रजिस्टी संख्या |
10534-89-1 |
| EINECS |
234-103-9 |
| आणविक संरचना |
|
| गलनांक |
217℃ |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
