ChemNet > CAS > 2757-23-5 chlorocarbonylsulfenyl chloride
2757-23-5 chlorocarbonylsulfenyl chloride
نام محصول |
chlorocarbonylsulfenyl chloride |
مترادف |
Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
میدان مغناطیسی |
CCl2OS |
وزن مولکولی |
130.9811 |
InChI |
InChI=1/CCl2OS/c2-1(4)5-3 |
شماره سیایاس |
2757-23-5 |
تعداد کمیسیون اروپایی |
220-415-2 |
ساختار مولکولی |
|
تراکم |
1.66g/cm3 |
نقطه غلیان |
98°C at 760 mmHg |
ضریب شکست |
1.53 |
نقطه اشتعال |
53.7°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|