ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
Nama produk |
methyl 4-cyanobenzoate |
Sinonim |
4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
MF |
C9H7NO2 |
Berat Molekul |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
CAS NO |
1129-35-7 |
EINECS |
214-443-4 |
Struktur Molekul |
|
Kepadatan |
1.18g/cm3 |
Titik lebur |
62℃ |
Titik didih |
274.9°C at 760 mmHg |
Indeks bias |
1.535 |
Titik nyala |
131.2°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|