3538-65-6 Butyric acid hydrazide
Naam product |
Butyric acid hydrazide |
Engelse naam |
Butyric acid hydrazide;Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
MF |
C4H10N2O |
Molecuulgewicht |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
CAS-nummer |
3538-65-6 |
EINECS |
222-579-0 |
Moleculaire Structuur |
|
Dichtheid |
0.98g/cm3 |
Kookpunt |
249.8°C at 760 mmHg |
Brekingsindex |
1.445 |
Vlampunt |
104.9°C |
Dampdruk |
0.0224mmHg at 25°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|