3538-65-6 Butyric acid hydrazide
produktnavn |
Butyric acid hydrazide |
Engelsk navn |
Butyric acid hydrazide;Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
Molekylær Formel |
C4H10N2O |
Molekylvekt |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
CAS-nummer |
3538-65-6 |
EINECS |
222-579-0 |
Molecular Structure |
|
Tetthet |
0.98g/cm3 |
Kokepunkt |
249.8°C at 760 mmHg |
Brytningsindeks |
1.445 |
Flammepunktet |
104.9°C |
Damptrykk |
0.0224mmHg at 25°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|