3538-65-6 Butyric acid hydrazide
اسم المنتج |
Butyric acid hydrazide |
الاسم بالانجليزية |
Butyric acid hydrazide;Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
الصيغة الجزيئية |
C4H10N2O |
الوزن الجزيئي الغرامي |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
إستراتيجية المساعدة القطرية |
3538-65-6 |
المفوضية الأوروبية رقم |
222-579-0 |
بنية جزيئية |
|
كثافة |
0.98g/cm3 |
نقطة الغليان |
249.8°C at 760 mmHg |
معامل الإنكسار |
1.445 |
نقطة الوميض |
104.9°C |
ضغط البخار |
0.0224mmHg at 25°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|