ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
Nazwa produktu: |
ethyl (R)-(-)-mandelate |
Synonimy |
(-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
MF |
C10H12O3 |
Masie cząsteczkowej |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
Nr CAS |
10606-72-1 |
Struktury molekularnej |
|
Gęstość |
1.147g/cm3 |
Temperatura topnienia |
33-34℃ |
Temperatura wrzenia |
254°C at 760 mmHg |
Współczynnik załamania |
1.528 |
Temperatura zapłonu |
118.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|