ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
| اسم المنتج |
2,3-Difluoro-4-methylbenzoic acid |
| الاسم المستعار |
2,3-Difluoro-p-toluic acid |
| الصيغة الجزيئية |
C8H6F2O2 |
| الوزن الجزيئي الغرامي |
172.1288 |
| InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
| إستراتيجية المساعدة القطرية |
261763-37-5 |
| بنية جزيئية |
|
| كثافة |
1.359g/cm3 |
| نقطة الغليان |
274°C at 760 mmHg |
| معامل الإنكسار |
1.511 |
| نقطة الوميض |
119.5°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
