ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
| Produkt-Name |
ethyl 2-methylnicotinate |
| Synonyme |
Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
| Molekulare Formel |
C9H11NO2 |
| Molecular Weight |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
| CAS Registry Number |
1721-26-2 |
| EINECS |
217-013-4 |
| Molecular Structure |
|
| Dichte |
1.077g/cm3 |
| Siedepunkt |
234.7°C at 760 mmHg |
| Brechungsindex |
1.506 |
| Flammpunkt |
86°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
