ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
| उत्पाद का नाम |
ethyl 2-methylnicotinate |
| समानार्थी |
Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
| आणविक फार्मूला |
C9H11NO2 |
| आण्विक वजन |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
| कैस रजिस्टी संख्या |
1721-26-2 |
| EINECS |
217-013-4 |
| आणविक संरचना |
|
| घनत्व |
1.077g/cm3 |
| उबलने का समय |
234.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.506 |
| फ्लैश प्वाइंट |
86°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
