ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
상품명칭 |
ethyl 2-methylnicotinate |
영문 이름 |
ethyl 2-methylnicotinate; Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
분자식 |
C9H11NO2 |
분자량 |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
cas번호 |
1721-26-2 |
EC번호 |
217-013-4 |
분자 구조 |
|
밀도 |
1.077g/cm3 |
비등점 |
234.7°C at 760 mmHg |
굴절 지수 |
1.506 |
인화점 |
86°C |
증기압 |
0.0521mmHg at 25°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|