ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
Ονομασία του προϊόντος |
ethyl 2-methylnicotinate |
Συνώνυμα |
Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
MF |
C9H11NO2 |
Μοριακό βάρος |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
CAS ΟΧΙ |
1721-26-2 |
EINECS |
217-013-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.077g/cm3 |
Σημείο βρασμού |
234.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.506 |
Σημείο ανάφλεξης |
86°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|