102-38-5 3-Nitroformanilide
Ονομασία του προϊόντος |
3-Nitroformanilide |
Αγγλικό όνομα |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
MF |
C7H6N2O3 |
Μοριακό βάρος |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
CAS ΟΧΙ |
102-38-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.407g/cm3 |
Σημείο βρασμού |
368.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.641 |
Σημείο ανάφλεξης |
176.7°C |
Πίεση ατμών |
1.27E-05mmHg at 25°C |
Κινδύνου Κώδικες |
R20/22:Harmful by inhalation and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|