102-38-5 3-Nitroformanilide
Nazwa produktu: |
3-Nitroformanilide |
Angielska nazwa |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
MF |
C7H6N2O3 |
Masie cząsteczkowej |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
Nr CAS |
102-38-5 |
Struktury molekularnej |
|
Gęstość |
1.407g/cm3 |
Temperatura wrzenia |
368.5°C at 760 mmHg |
Współczynnik załamania |
1.641 |
Temperatura zapłonu |
176.7°C |
Ciśnienie pary |
1.27E-05mmHg at 25°C |
Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|