102-38-5 3-Nitroformanilide
نام محصول |
3-Nitroformanilide |
نام انگلیسی |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
میدان مغناطیسی |
C7H6N2O3 |
وزن مولکولی |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
شماره سیایاس |
102-38-5 |
ساختار مولکولی |
|
تراکم |
1.407g/cm3 |
نقطه غلیان |
368.5°C at 760 mmHg |
ضریب شکست |
1.641 |
نقطه اشتعال |
176.7°C |
فشار بخار |
1.27E-05mmHg at 25°C |
کدهای خطر |
R20/22:Harmful by inhalation and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|