ChemNet > CAS > 102-38-5 3-Nitroformanilide
102-38-5 3-Nitroformanilide
Naam product |
3-Nitroformanilide |
Synoniemen |
N-(3-nitrophenyl)formamide |
MF |
C7H6N2O3 |
Molecuulgewicht |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
CAS-nummer |
102-38-5 |
Moleculaire Structuur |
|
Dichtheid |
1.407g/cm3 |
Kookpunt |
368.5°C at 760 mmHg |
Brekingsindex |
1.641 |
Vlampunt |
176.7°C |
Gevaarsymbolen |
|
Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|