102-38-5 3-Nitroformanilide
Nome del prodotto |
3-Nitroformanilide |
Nome inglese |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
Formula molecolare |
C7H6N2O3 |
Peso Molecolare |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
Numero CAS |
102-38-5 |
Struttura molecolare |
|
Densità |
1.407g/cm3 |
Punto di ebollizione |
368.5°C at 760 mmHg |
Indice di rifrazione |
1.641 |
Punto d'infiammabilità |
176.7°C |
Pressione di vapore |
1.27E-05mmHg at 25°C |
Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
|
Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|