ChemNet > CAS > 656-32-6 1-(2-fluorophenyl)-2-thiourea
656-32-6 1-(2-fluorophenyl)-2-thiourea
שם המוצר |
1-(2-fluorophenyl)-2-thiourea |
שם אנגלי |
1-(2-fluorophenyl)-2-thiourea; 2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
מולקולרית פורמולה |
C7H7FN2S |
משקל מולקולרי |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
מספר CAS |
656-32-6 |
מבנה מולקולרי |
|
צפיפות |
1.397g/cm3 |
נקודת ההתוך |
143-145℃ |
נקודת רתיחה |
257°C at 760 mmHg |
משקל סגולי |
1.692 |
נקודת הבזק |
109.2°C |
לחץ אדים |
0.0149mmHg at 25°C |
סיכונים קודי |
R25:Toxic if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|