ChemNet > CAS > 656-32-6 1-(2-fluorophenyl)-2-thiourea
656-32-6 1-(2-fluorophenyl)-2-thiourea
| Название продукта |
1-(2-fluorophenyl)-2-thiourea |
| Синонимы |
2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
| Молекулярная формула |
C7H7FN2S |
| Молекулярный вес |
170.2073 |
| InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Регистрационный номер CAS |
656-32-6 |
| Молекулярная структура |
|
| Плотность |
1.397g/cm3 |
| Температура плавления |
143-145℃ |
| Точка кипения |
257°C at 760 mmHg |
| Показатель преломления |
1.692 |
| Температура вспышки |
109.2°C |
| Символы опасности |
|
| Риск коды |
R25:Toxic if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
