ChemNet > CAS > 656-32-6 1-(2-fluorophenyl)-2-thiourea
656-32-6 1-(2-fluorophenyl)-2-thiourea
상품명칭 |
1-(2-fluorophenyl)-2-thiourea |
영문 이름 |
1-(2-fluorophenyl)-2-thiourea; 2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
분자식 |
C7H7FN2S |
분자량 |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
cas번호 |
656-32-6 |
분자 구조 |
|
밀도 |
1.397g/cm3 |
녹는 점 |
143-145℃ |
비등점 |
257°C at 760 mmHg |
굴절 지수 |
1.692 |
인화점 |
109.2°C |
증기압 |
0.0149mmHg at 25°C |
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|