ChemNet > CAS > 656-32-6 1-(2-fluorophenyl)-2-thiourea
656-32-6 1-(2-fluorophenyl)-2-thiourea
Nazwa produktu: |
1-(2-fluorophenyl)-2-thiourea |
Angielska nazwa |
1-(2-fluorophenyl)-2-thiourea; 2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
MF |
C7H7FN2S |
Masie cząsteczkowej |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
Nr CAS |
656-32-6 |
Struktury molekularnej |
|
Gęstość |
1.397g/cm3 |
Temperatura topnienia |
143-145℃ |
Temperatura wrzenia |
257°C at 760 mmHg |
Współczynnik załamania |
1.692 |
Temperatura zapłonu |
109.2°C |
Ciśnienie pary |
0.0149mmHg at 25°C |
Kody ryzyka |
R25:Toxic if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|