ChemNet > CAS > 656-32-6 1-(2-fluorophenyl)-2-thiourea
656-32-6 1-(2-fluorophenyl)-2-thiourea
نام محصول |
1-(2-fluorophenyl)-2-thiourea |
مترادف |
2-Fluorophenylthiourea; 1-(2-fluorophenyl)thiourea |
میدان مغناطیسی |
C7H7FN2S |
وزن مولکولی |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
شماره سیایاس |
656-32-6 |
ساختار مولکولی |
|
تراکم |
1.397g/cm3 |
نقطه ذوب |
143-145℃ |
نقطه غلیان |
257°C at 760 mmHg |
ضریب شکست |
1.692 |
نقطه اشتعال |
109.2°C |
خطر نمادها |
|
کدهای خطر |
R25:Toxic if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|